Assalamualaikum, today I'm will introduce you about SMILES application
Simplified molecular input line entry specification (SMILES)
it is a software describing the structure of chemical molecular using short ASCII strings. Smile strings can be imported by most molecule editors for conversion back into two-dimensional drawings or three-dimensional models of the molecules.
the image is the example of SMILES application.
the image is the example of SMILES application.
The term Canonical SMILES refers to the version of the SMILES specification that includes rules for ensuring that each distinct chemical molecule has a single unique SMILES representation
- A common application of Canonical SMILES is for indexing and ensuring uniqueness of molecules in a database
The term Isomeric SMILES refers to the version of the SMILES specification that includes extensions to support the specification of isotopes, chirality, and configuration about double bonds
- A notable feature of these rules is that they allow rigorous partial specification of chirality.
SMILES Bonds
| SINGLE | - |
| DOUBLE | = |
| TRIPLE | # |
| AROMATIC | : |
SMILES Branches
- Represented by enclosure in parentheses
- Can be nested or stacked
- Examples:
CC(O)CC is 2-Butanol
OCC(C)C is iso-Butanol
OC(C)(C)C is tert-Butanol
SMILES BONDS
| Ethene | C=C |
| Chloroethene | ClC=C |
| 1,1-Dichloroethene | ClC(Cl)=C |
| cis-1,2-Dichloroethene | ClC=CCl |
| Trichloroethene | ClC(Cl)=CCl |
| Perchloroethene | ClC(Cl)=C(Cl)Cl |
Table below show some of molecular structures and its SMILES formula.
Application on some molecules
| Molecule | Structure | SMILES Formula |
|---|---|---|
| Dinitrogen | N≡N | N#N |
| Methyl isocyanate (MIC) | CH3–N=C=O | CN=C=O |
| Copper(II) sulfate | Cu2+ SO42- | [Cu+2].[O-]S(=O)(=O)[O-] |
| Œnanthotoxin (C17H22O2) | CCC[C@@H](O)CC\C=C\C=C\C#CC#C\C=C\CO | |
| Pyrethrin II (C22H28O5) | COC(=O)C(\C)=C\C1C(C)(C)[C@H]1C(=O)O[C@@H]2C(C)=C(C(=O)C2)CC=CC=C | |
| Aflatoxin B1 (C17H12O6) | O1C=C[C@H]([C@H]1O2)c3c2cc(OC)c4c3OC(=O)C5=C4CCC(=O)5 | |
| Glucose (glucopyranose) (C6H12O6) | OC[C@@H](O1)[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)1 | |
| Bergenin (cuscutin) (a resin) (C14H16O9) | OC[C@@H](O1)[C@@H](O)[C@H](O)[C@@H]2[C@@H]1c3c(O)c(OC)c(O)cc3C(=O)O2 | |
| A pheromone of the Californian scale insect | CC(=O)OCCC(/C)=C\C[C@H](C(C)=C)CCC=C | |
| 2S,5R-Chalcogran: a pheromone of the bark beetle Pityogenes chalcographus[8] | CC[C@H](O1)CC[C@@]12CCCO2 | |
| Vanillin | O=Cc1ccc(O)c(OC)c1 | |
| Melatonin (C13H16N2O2) | CC(=O)NCCC1=CNc2c1cc(OC)cc2 | |
| Flavopereirin (C17H15N2) | CCc(c1)ccc2[n+]1ccc3c2Nc4c3cccc4 | |
| Nicotine (C10H14N2) | CN1CCC[C@H]1c2cccnc2 | |
| Alpha-thujone (C10H16O) | CC(C)[C@@]12C[C@@H]1[C@@H](C)C(=O)C2 | |
| Thiamin (C12H17N4OS+) (vitamin B1) | OCCc1c(C)[n+](=cs1)Cc2cnc(C)nc(N)2 |
to download the software go to this http://chemsketch.en.softonic.com/.







0 comments:
Post a Comment